C9H17N4O9P — CID 18666812
[(2R,3S,4S)-5-[(5-amino-2,4-dioxo-1H-pyrimidin-6-yl)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate (PubChem CID 18666812) has the molecular formula C9H17N4O9P and a molecular weight of 356.23 g/mol. Its IUPAC name is [(2R,3S,4S)-5-[(5-amino-2,4-dioxo-1H-pyrimidin-6-yl)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4S)-5-[(5-amino-2,4-dioxo-1H-pyrimidin-6-yl)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 18666812 |
| Molecular Formula | C9H17N4O9P |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [(2R,3S,4S)-5-[(5-amino-2,4-dioxo-1H-pyrimidin-6-yl)amino]-2,3,4-trihydroxypentyl] dihydrogen phosphate |
| SMILES | Nc1c(NC[C@H](O)[C@H](O)[C@H](O)COP(=O)(O)O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H17N4O9P/c10-5-7(12-9(18)13-8(5)17)11-1-3(14)6(16)4(15)2-22-23(19,20)21/h3-4,6,14-16H,1-2,10H2,(H2,19,20,21)(H3,11,12,13,17,18)/t3-,4+,6-/m0/s1 |
| InChIKey | RQRINYISXYAZKL-RPDRRWSUSA-N |
| XLogP | -3.75 |
| TPSA | 231.22 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | -3.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|