C23H25N3O3 — CID 18666823
(3R,4S)-4-(N-[(Z)-2-amino-4-oxopent-2-enyl]anilino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile (PubChem CID 18666823) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (3R,4S)-4-(N-[(Z)-2-amino-4-oxopent-2-enyl]anilino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile.
| Compound Name | (3R,4S)-4-(N-[(Z)-2-amino-4-oxopent-2-enyl]anilino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
|---|---|
| PubChem CID | 18666823 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (3R,4S)-4-(N-[(Z)-2-amino-4-oxopent-2-enyl]anilino)-3-hydroxy-2,2-dimethyl-3,4-dihydrochromene-6-carbonitrile |
| SMILES | CC(=O)/C=C(\N)CN(c1ccccc1)[C@H]1c2cc(C#N)ccc2OC(C)(C)[C@@H]1O |
| InChI | InChI=1S/C23H25N3O3/c1-15(27)11-17(25)14-26(18-7-5-4-6-8-18)21-19-12-16(13-24)9-10-20(19)29-23(2,3)22(21)28/h4-12,21-22,28H,14,25H2,1-3H3/b17-11-/t21-,22+/m0/s1 |
| InChIKey | WSTKLZUWXGLOHR-GMLUUEFSSA-N |
| XLogP | 3.07 |
| TPSA | 99.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|