C40H48N4O6 — CID 18667015
(2S)-N-benzyl-N-(1,5-dipyridin-4-ylpentan-3-yl)-4-methyl-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]pentanamide (PubChem CID 18667015) has the molecular formula C40H48N4O6 and a molecular weight of 680.85 g/mol. Its IUPAC name is (2S)-N-benzyl-N-(1,5-dipyridin-4-ylpentan-3-yl)-4-methyl-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]pentanamide.
| Compound Name | (2S)-N-benzyl-N-(1,5-dipyridin-4-ylpentan-3-yl)-4-methyl-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]pentanamide |
|---|---|
| PubChem CID | 18667015 |
| Molecular Formula | C40H48N4O6 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.36 |
| IUPAC Name | (2S)-N-benzyl-N-(1,5-dipyridin-4-ylpentan-3-yl)-4-methyl-2-[methyl-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]amino]pentanamide |
| SMILES | COc1cc(C(=O)C(=O)N(C)[C@@H](CC(C)C)C(=O)N(Cc2ccccc2)C(CCc2ccncc2)CCc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C40H48N4O6/c1-28(2)24-34(43(3)40(47)37(45)32-25-35(48-4)38(50-6)36(26-32)49-5)39(46)44(27-31-10-8-7-9-11-31)33(14-12-29-16-20-41-21-17-29)15-13-30-18-22-42-23-19-30/h7-11,16-23,25-26,28,33-34H,12-15,24,27H2,1-6H3/t34-/m0/s1 |
| InChIKey | WVEXTLDBIXYYSY-UMSFTDKQSA-N |
| XLogP | 6.22 |
| TPSA | 111.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|