About (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol
(2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 18667020) has the molecular formula C5H9FO4
and a molecular weight of 152.12 g/mol. Its IUPAC name is (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol.
Analyze (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol?
The IUPAC name of (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol (CID 18667020) is (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol.
What is the SMILES notation for (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol?
The canonical SMILES for (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol is OC[C@H]1OC[C@@](O)(F)[C@H]1O.
What is the InChIKey of (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol?
The InChIKey is MSWWQBCCPHMALH-WISUUJSJSA-N. The full InChI is InChI=1S/C5H9FO4/c6-5(9)2-10-3(1-7)4(5)8/h3-4,7-9H,1-2H2/t3-,4+,5+/m1/s1.
What are the key properties of (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol?
(2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol has a molecular weight of 152.12 g/mol, XLogP of -1.60, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4R)-4-fluoro-2-(hydroxymethyl)oxolane-3,4-diol is sourced from PubChem (CID 18667020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).