C21H40O4Si2 — CID 18667135
2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]acetic acid (PubChem CID 18667135) has the molecular formula C21H40O4Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]acetic acid.
| Compound Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]acetic acid |
|---|---|
| PubChem CID | 18667135 |
| Molecular Formula | C21H40O4Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methylidenecyclohexylidene]acetic acid |
| SMILES | C=C1[C@H](O[Si](C)(C)C(C)(C)C)CC(=CC(=O)O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H40O4Si2/c1-15-17(24-26(8,9)20(2,3)4)12-16(14-19(22)23)13-18(15)25-27(10,11)21(5,6)7/h14,17-18H,1,12-13H2,2-11H3,(H,22,23)/t17-,18-/m1/s1 |
| InChIKey | VSPAWPROZXKZNJ-QZTJIDSGSA-N |
| XLogP | 6.13 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|