C15H31NO6 — CID 18667373
3-ethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide (PubChem CID 18667373) has the molecular formula C15H31NO6 and a molecular weight of 321.41 g/mol. Its IUPAC name is 3-ethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide.
| Compound Name | 3-ethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide |
|---|---|
| PubChem CID | 18667373 |
| Molecular Formula | C15H31NO6 |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 3-ethyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]heptanamide |
| SMILES | CCCCC(CC)CC(=O)NC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H31NO6/c1-3-5-6-10(4-2)7-13(20)16-8-11(18)14(21)15(22)12(19)9-17/h10-12,14-15,17-19,21-22H,3-9H2,1-2H3,(H,16,20)/t10?,11-,12+,14+,15+/m0/s1 |
| InChIKey | MWVVUHPTMIYPPS-IFBZQCCDSA-N |
| XLogP | -0.86 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |