About (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane
(1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane (PubChem CID 18667888) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane.
Molecular Properties
| Compound Name | (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane |
| PubChem CID | 18667888 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane |
| SMILES | COC(OC)(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C13H26O2/c1-12(2,3)13(14-4,15-5)11-9-7-6-8-10-11/h11H,6-10H2,1-5H3 |
| InChIKey | IELPVMKWCTYJIC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane?
The IUPAC name of (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane (CID 18667888) is (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane.
What is the SMILES notation for (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane?
The canonical SMILES for (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane is COC(OC)(C1CCCCC1)C(C)(C)C.
What is the InChIKey of (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane?
The InChIKey is IELPVMKWCTYJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-12(2,3)13(14-4,15-5)11-9-7-6-8-10-11/h11H,6-10H2,1-5H3.
What are the key properties of (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane?
(1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane has a molecular weight of 214.35 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dimethoxy-2,2-dimethylpropyl)cyclohexane is sourced from PubChem (CID 18667888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).