C11H5F15O2 — CID 18667917
2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluorodecanoic acid (PubChem CID 18667917) has the molecular formula C11H5F15O2 and a molecular weight of 454.13 g/mol. Its IUPAC name is 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluorodecanoic acid.
| Compound Name | 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluorodecanoic acid |
|---|---|
| PubChem CID | 18667917 |
| Molecular Formula | C11H5F15O2 |
| Molecular Weight | 454.13 g/mol |
| Exact Mass | 454.01 |
| IUPAC Name | 2-(difluoromethylidene)-3,3,4,4,5,5,6,6,7,7,8,8,9-tridecafluorodecanoic acid |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(=O)O)=C(F)F |
| InChI | InChI=1S/C11H5F15O2/c1-2(12)6(15,16)8(19,20)10(23,24)11(25,26)9(21,22)7(17,18)3(4(13)14)5(27)28/h2H,1H3,(H,27,28) |
| InChIKey | RUMIKZVOZTZNCL-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.13 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|