About N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide
N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide (PubChem CID 18667987) has the molecular formula C7H8N2OS2
and a molecular weight of 200.29 g/mol. Its IUPAC name is N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide.
Molecular Properties
| Compound Name | N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide |
| PubChem CID | 18667987 |
| Molecular Formula | C7H8N2OS2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1ncc(C(C)=S)s1 |
| InChI | InChI=1S/C7H8N2OS2/c1-4(11)6-3-8-7(12-6)9-5(2)10/h3H,1-2H3,(H,8,9,10) |
| InChIKey | OMESYZOSDFCMFD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide?
The IUPAC name of N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide (CID 18667987) is N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide.
What is the SMILES notation for N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide?
The canonical SMILES for N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide is CC(=O)Nc1ncc(C(C)=S)s1.
What is the InChIKey of N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide?
The InChIKey is OMESYZOSDFCMFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2OS2/c1-4(11)6-3-8-7(12-6)9-5(2)10/h3H,1-2H3,(H,8,9,10).
What are the key properties of N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide?
N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide has a molecular weight of 200.29 g/mol, XLogP of 1.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethanethioyl-1,3-thiazol-2-yl)acetamide is sourced from PubChem (CID 18667987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).