About 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid
4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid (PubChem CID 18668452) has the molecular formula C15H26O7
and a molecular weight of 318.37 g/mol. Its IUPAC name is 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid |
| PubChem CID | 18668452 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid |
| SMILES | CCC(CC)OC1C(OC)C(C(=O)O)CC(C(=O)O)C1OC |
| InChI | InChI=1S/C15H26O7/c1-5-8(6-2)22-13-11(20-3)9(14(16)17)7-10(15(18)19)12(13)21-4/h8-13H,5-7H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | YRDJDCYKPNXMTD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid?
The IUPAC name of 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid (CID 18668452) is 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid.
What is the SMILES notation for 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid?
The canonical SMILES for 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid is CCC(CC)OC1C(OC)C(C(=O)O)CC(C(=O)O)C1OC.
What is the InChIKey of 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid?
The InChIKey is YRDJDCYKPNXMTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O7/c1-5-8(6-2)22-13-11(20-3)9(14(16)17)7-10(15(18)19)12(13)21-4/h8-13H,5-7H2,1-4H3,(H,16,17)(H,18,19).
What are the key properties of 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid?
4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid has a molecular weight of 318.37 g/mol, XLogP of 1.40, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxy-5-pentan-3-yloxycyclohexane-1,3-dicarboxylic acid is sourced from PubChem (CID 18668452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).