C39H34FN3O2 — CID 18668649
2-fluoro-5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]benzamide (PubChem CID 18668649) has the molecular formula C39H34FN3O2 and a molecular weight of 595.72 g/mol. Its IUPAC name is 2-fluoro-5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]benzamide.
| Compound Name | 2-fluoro-5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]benzamide |
|---|---|
| PubChem CID | 18668649 |
| Molecular Formula | C39H34FN3O2 |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.26 |
| IUPAC Name | 2-fluoro-5-[4-[1-hydroxy-2-methyl-1-(1-tritylimidazol-4-yl)propyl]phenyl]benzamide |
| SMILES | CC(C)C(O)(c1ccc(-c2ccc(F)c(C(N)=O)c2)cc1)c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C39H34FN3O2/c1-27(2)39(45,33-21-18-28(19-22-33)29-20-23-35(40)34(24-29)37(41)44)36-25-43(26-42-36)38(30-12-6-3-7-13-30,31-14-8-4-9-15-31)32-16-10-5-11-17-32/h3-27,45H,1-2H3,(H2,41,44) |
| InChIKey | UZARYVSLBXVFTO-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|