About 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline
4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline (PubChem CID 18668759) has the molecular formula C19H20ClF3N4O
and a molecular weight of 412.84 g/mol. Its IUPAC name is 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline.
Molecular Properties
| Compound Name | 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline |
| PubChem CID | 18668759 |
| Molecular Formula | C19H20ClF3N4O |
| Molecular Weight | 412.84 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline |
| SMILES | COc1ccc2nc(Cl)c3nc(C(F)(F)F)n(CCC4CCNCC4)c3c2c1 |
| InChI | InChI=1S/C19H20ClF3N4O/c1-28-12-2-3-14-13(10-12)16-15(17(20)25-14)26-18(19(21,22)23)27(16)9-6-11-4-7-24-8-5-11/h2-3,10-11,24H,4-9H2,1H3 |
| InChIKey | NKZPEJIIANZKMW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline?
The IUPAC name of 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline (CID 18668759) is 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline.
What is the SMILES notation for 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline?
The canonical SMILES for 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline is COc1ccc2nc(Cl)c3nc(C(F)(F)F)n(CCC4CCNCC4)c3c2c1.
What is the InChIKey of 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline?
The InChIKey is NKZPEJIIANZKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClF3N4O/c1-28-12-2-3-14-13(10-12)16-15(17(20)25-14)26-18(19(21,22)23)27(16)9-6-11-4-7-24-8-5-11/h2-3,10-11,24H,4-9H2,1H3.
What are the key properties of 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline?
4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline has a molecular weight of 412.84 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-8-methoxy-1-(2-piperidin-4-ylethyl)-2-(trifluoromethyl)imidazo[4,5-c]quinoline is sourced from PubChem (CID 18668759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).