About 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine
4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine (PubChem CID 18668828) has the molecular formula C11H7Cl3F3N3S
and a molecular weight of 376.62 g/mol. Its IUPAC name is 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine |
| PubChem CID | 18668828 |
| Molecular Formula | C11H7Cl3F3N3S |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine |
| SMILES | CSc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1Cl |
| InChI | InChI=1S/C11H7Cl3F3N3S/c1-21-10-7(14)9(18)20(19-10)8-5(12)2-4(3-6(8)13)11(15,16)17/h2-3H,18H2,1H3 |
| InChIKey | XVFJUDUNNHPHLN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine?
The IUPAC name of 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine (CID 18668828) is 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine.
What is the SMILES notation for 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine?
The canonical SMILES for 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine is CSc1nn(-c2c(Cl)cc(C(F)(F)F)cc2Cl)c(N)c1Cl.
What is the InChIKey of 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine?
The InChIKey is XVFJUDUNNHPHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Cl3F3N3S/c1-21-10-7(14)9(18)20(19-10)8-5(12)2-4(3-6(8)13)11(15,16)17/h2-3H,18H2,1H3.
What are the key properties of 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine?
4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine has a molecular weight of 376.62 g/mol, XLogP of 5.16, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-3-methylsulfanylpyrazol-5-amine is sourced from PubChem (CID 18668828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).