About 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid
2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 18668957) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| PubChem CID | 18668957 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid |
| SMILES | CC1=CCC(C(=O)O)=C(C)N1 |
| InChI | InChI=1S/C8H11NO2/c1-5-3-4-7(8(10)11)6(2)9-5/h3,9H,4H2,1-2H3,(H,10,11) |
| InChIKey | BNTNXGJDVSDDOG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The IUPAC name of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CID 18668957) is 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
What is the SMILES notation for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The canonical SMILES for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid is CC1=CCC(C(=O)O)=C(C)N1.
What is the InChIKey of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The InChIKey is BNTNXGJDVSDDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-3-4-7(8(10)11)6(2)9-5/h3,9H,4H2,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid has a molecular weight of 153.18 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid is sourced from PubChem (CID 18668957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).