2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid

C8H11NO2 — CID 18668957

IUPAC2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid
SMILESCC1=CCC(C(=O)O)=C(C)N1
InChIInChI=1S/C8H11NO2/c1-5-3-4-7(8(10)11)6(2)9-5/h3,9H,4H2,1-2H3,(H,10,11)
InChIKeyBNTNXGJDVSDDOG-UHFFFAOYSA-N
MW153.18 g/mol
LogP1.24
Rot. Bonds1

About 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid

2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (PubChem CID 18668957) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.

Molecular Properties

Compound Name2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid
PubChem CID18668957
Molecular FormulaC8H11NO2
Molecular Weight153.18 g/mol
Exact Mass153.08
IUPAC Name2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid
SMILESCC1=CCC(C(=O)O)=C(C)N1
InChIInChI=1S/C8H11NO2/c1-5-3-4-7(8(10)11)6(2)9-5/h3,9H,4H2,1-2H3,(H,10,11)
InChIKeyBNTNXGJDVSDDOG-UHFFFAOYSA-N
XLogP1.24
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.18
LogP ≤ 51.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The IUPAC name of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid (CID 18668957) is 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid.
What is the SMILES notation for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The canonical SMILES for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid is CC1=CCC(C(=O)O)=C(C)N1.
What is the InChIKey of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
The InChIKey is BNTNXGJDVSDDOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5-3-4-7(8(10)11)6(2)9-5/h3,9H,4H2,1-2H3,(H,10,11).
What are the key properties of 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid?
2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid has a molecular weight of 153.18 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-1,4-dihydropyridine-3-carboxylic acid is sourced from PubChem (CID 18668957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).