C22H23Cl2N3O — CID 18669066
3-[5-chloro-2-(4-chlorophenyl)-1-methylindol-3-yl]-1-piperazin-1-ylpropan-1-one (PubChem CID 18669066) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 3-[5-chloro-2-(4-chlorophenyl)-1-methylindol-3-yl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[5-chloro-2-(4-chlorophenyl)-1-methylindol-3-yl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 18669066 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 3-[5-chloro-2-(4-chlorophenyl)-1-methylindol-3-yl]-1-piperazin-1-ylpropan-1-one |
| SMILES | Cn1c(-c2ccc(Cl)cc2)c(CCC(=O)N2CCNCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H23Cl2N3O/c1-26-20-8-6-17(24)14-19(20)18(22(26)15-2-4-16(23)5-3-15)7-9-21(28)27-12-10-25-11-13-27/h2-6,8,14,25H,7,9-13H2,1H3 |
| InChIKey | ARWGBMVIZUGELW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |