About 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine
8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine (PubChem CID 18670509) has the molecular formula C13H9N5O
and a molecular weight of 251.25 g/mol. Its IUPAC name is 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine.
Molecular Properties
| Compound Name | 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine |
| PubChem CID | 18670509 |
| Molecular Formula | C13H9N5O |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine |
| SMILES | c1cn(-c2ccc3c(c2)Nc2nccnc2O3)cn1 |
| InChI | InChI=1S/C13H9N5O/c1-2-11-10(7-9(1)18-6-5-14-8-18)17-12-13(19-11)16-4-3-15-12/h1-8H,(H,15,17) |
| InChIKey | XPOGKXKYUYXFTD-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine?
The IUPAC name of 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine (CID 18670509) is 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine.
What is the SMILES notation for 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine?
The canonical SMILES for 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine is c1cn(-c2ccc3c(c2)Nc2nccnc2O3)cn1.
What is the InChIKey of 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine?
The InChIKey is XPOGKXKYUYXFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N5O/c1-2-11-10(7-9(1)18-6-5-14-8-18)17-12-13(19-11)16-4-3-15-12/h1-8H,(H,15,17).
What are the key properties of 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine?
8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine has a molecular weight of 251.25 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-imidazol-1-yl-10H-pyrazino[2,3-b][1,4]benzoxazine is sourced from PubChem (CID 18670509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).