About 2,4-dichlorobutanal
2,4-dichlorobutanal (PubChem CID 18670627) has the molecular formula C4H6Cl2O
and a molecular weight of 141.00 g/mol. Its IUPAC name is 2,4-dichlorobutanal.
Molecular Properties
| Compound Name | 2,4-dichlorobutanal |
| PubChem CID | 18670627 |
| Molecular Formula | C4H6Cl2O |
| Molecular Weight | 141.00 g/mol |
| Exact Mass | 139.98 |
| IUPAC Name | 2,4-dichlorobutanal |
| SMILES | O=CC(Cl)CCCl |
| InChI | InChI=1S/C4H6Cl2O/c5-2-1-4(6)3-7/h3-4H,1-2H2 |
| InChIKey | ZHZWRTDQJMBLBL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.00 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dichlorobutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichlorobutanal?
The IUPAC name of 2,4-dichlorobutanal (CID 18670627) is 2,4-dichlorobutanal.
What is the SMILES notation for 2,4-dichlorobutanal?
The canonical SMILES for 2,4-dichlorobutanal is O=CC(Cl)CCCl.
What is the InChIKey of 2,4-dichlorobutanal?
The InChIKey is ZHZWRTDQJMBLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2O/c5-2-1-4(6)3-7/h3-4H,1-2H2.
What are the key properties of 2,4-dichlorobutanal?
2,4-dichlorobutanal has a molecular weight of 141.00 g/mol, XLogP of 1.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichlorobutanal is sourced from PubChem (CID 18670627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).