About 1-(diethoxymethyl)-1,2,4-triazole
1-(diethoxymethyl)-1,2,4-triazole (PubChem CID 18670731) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is 1-(diethoxymethyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-(diethoxymethyl)-1,2,4-triazole |
| PubChem CID | 18670731 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 1-(diethoxymethyl)-1,2,4-triazole |
| SMILES | CCOC(OCC)n1cncn1 |
| InChI | InChI=1S/C7H13N3O2/c1-3-11-7(12-4-2)10-6-8-5-9-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | BFYYAMMWKCRKDG-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(diethoxymethyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(diethoxymethyl)-1,2,4-triazole?
The IUPAC name of 1-(diethoxymethyl)-1,2,4-triazole (CID 18670731) is 1-(diethoxymethyl)-1,2,4-triazole.
What is the SMILES notation for 1-(diethoxymethyl)-1,2,4-triazole?
The canonical SMILES for 1-(diethoxymethyl)-1,2,4-triazole is CCOC(OCC)n1cncn1.
What is the InChIKey of 1-(diethoxymethyl)-1,2,4-triazole?
The InChIKey is BFYYAMMWKCRKDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-3-11-7(12-4-2)10-6-8-5-9-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 1-(diethoxymethyl)-1,2,4-triazole?
1-(diethoxymethyl)-1,2,4-triazole has a molecular weight of 171.20 g/mol, XLogP of 0.81, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(diethoxymethyl)-1,2,4-triazole is sourced from PubChem (CID 18670731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).