About N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide
N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide (PubChem CID 18670943) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide.
Molecular Properties
| Compound Name | N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide |
| PubChem CID | 18670943 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide |
| SMILES | O=C(NCC1=CCCC=C1)N1CCC1 |
| InChI | InChI=1S/C11H16N2O/c14-11(13-7-4-8-13)12-9-10-5-2-1-3-6-10/h2,5-6H,1,3-4,7-9H2,(H,12,14) |
| InChIKey | SESJESKYKRYXRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide?
The IUPAC name of N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide (CID 18670943) is N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide.
What is the SMILES notation for N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide?
The canonical SMILES for N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide is O=C(NCC1=CCCC=C1)N1CCC1.
What is the InChIKey of N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide?
The InChIKey is SESJESKYKRYXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O/c14-11(13-7-4-8-13)12-9-10-5-2-1-3-6-10/h2,5-6H,1,3-4,7-9H2,(H,12,14).
What are the key properties of N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide?
N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide has a molecular weight of 192.26 g/mol, XLogP of 1.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyclohexa-1,5-dien-1-ylmethyl)azetidine-1-carboxamide is sourced from PubChem (CID 18670943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).