About 2,6-ditert-butyl-2H-pyran
2,6-ditert-butyl-2H-pyran (PubChem CID 18671210) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2,6-ditert-butyl-2H-pyran.
Molecular Properties
| Compound Name | 2,6-ditert-butyl-2H-pyran |
| PubChem CID | 18671210 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2,6-ditert-butyl-2H-pyran |
| SMILES | CC(C)(C)C1=CC=CC(C(C)(C)C)O1 |
| InChI | InChI=1S/C13H22O/c1-12(2,3)10-8-7-9-11(14-10)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | KCUIIVDHDWZNAQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-ditert-butyl-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-ditert-butyl-2H-pyran?
The IUPAC name of 2,6-ditert-butyl-2H-pyran (CID 18671210) is 2,6-ditert-butyl-2H-pyran.
What is the SMILES notation for 2,6-ditert-butyl-2H-pyran?
The canonical SMILES for 2,6-ditert-butyl-2H-pyran is CC(C)(C)C1=CC=CC(C(C)(C)C)O1.
What is the InChIKey of 2,6-ditert-butyl-2H-pyran?
The InChIKey is KCUIIVDHDWZNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-12(2,3)10-8-7-9-11(14-10)13(4,5)6/h7-10H,1-6H3.
What are the key properties of 2,6-ditert-butyl-2H-pyran?
2,6-ditert-butyl-2H-pyran has a molecular weight of 194.32 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-ditert-butyl-2H-pyran is sourced from PubChem (CID 18671210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).