C16H25N3O5 — CID 18671256
6-amino-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoic acid (PubChem CID 18671256) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is 6-amino-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 18671256 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 6-amino-2-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)CCCCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C16H25N3O5/c17-10-4-3-6-12(16(23)24)18-13(20)7-2-1-5-11-19-14(21)8-9-15(19)22/h8-9,12H,1-7,10-11,17H2,(H,18,20)(H,23,24) |
| InChIKey | OQMSUSITQGKAEJ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|