About (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate
(2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 18671261) has the molecular formula C14H20N2O5
and a molecular weight of 296.32 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate |
| PubChem CID | 18671261 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)NCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H20N2O5/c1-10(2)14(20)15-9-5-3-4-6-13(19)21-16-11(17)7-8-12(16)18/h1,3-9H2,2H3,(H,15,20) |
| InChIKey | SLWUKPUCCZFJQM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate (CID 18671261) is (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate is C=C(C)C(=O)NCCCCCC(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate?
The InChIKey is SLWUKPUCCZFJQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O5/c1-10(2)14(20)15-9-5-3-4-6-13(19)21-16-11(17)7-8-12(16)18/h1,3-9H2,2H3,(H,15,20).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate?
(2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate has a molecular weight of 296.32 g/mol, XLogP of 0.85, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 6-(2-methylprop-2-enoylamino)hexanoate is sourced from PubChem (CID 18671261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).