C14H5F11N2O2 — CID 18671301
4-[6-(1,1,2,2,2-pentafluoroethyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazin-2-yl]benzaldehyde (PubChem CID 18671301) has the molecular formula C14H5F11N2O2 and a molecular weight of 442.18 g/mol. Its IUPAC name is 4-[6-(1,1,2,2,2-pentafluoroethyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazin-2-yl]benzaldehyde.
| Compound Name | 4-[6-(1,1,2,2,2-pentafluoroethyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazin-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 18671301 |
| Molecular Formula | C14H5F11N2O2 |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 4-[6-(1,1,2,2,2-pentafluoroethyl)-4,4-bis(trifluoromethyl)-1,3,5-oxadiazin-2-yl]benzaldehyde |
| SMILES | O=Cc1ccc(C2=NC(C(F)(F)F)(C(F)(F)F)N=C(C(F)(F)C(F)(F)F)O2)cc1 |
| InChI | InChI=1S/C14H5F11N2O2/c15-10(16,12(17,18)19)9-27-11(13(20,21)22,14(23,24)25)26-8(29-9)7-3-1-6(5-28)2-4-7/h1-5H |
| InChIKey | NUMHSYASJDYAIG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|