About N-phenyltetrazol-1-amine
N-phenyltetrazol-1-amine (PubChem CID 18671860) has the molecular formula C7H7N5
and a molecular weight of 161.17 g/mol. Its IUPAC name is N-phenyltetrazol-1-amine.
Molecular Properties
| Compound Name | N-phenyltetrazol-1-amine |
| PubChem CID | 18671860 |
| Molecular Formula | C7H7N5 |
| Molecular Weight | 161.17 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | N-phenyltetrazol-1-amine |
| SMILES | c1ccc(Nn2cnnn2)cc1 |
| InChI | InChI=1S/C7H7N5/c1-2-4-7(5-3-1)9-12-6-8-10-11-12/h1-6,9H |
| InChIKey | AYXRANNMPTXHLO-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.17 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-phenyltetrazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenyltetrazol-1-amine?
The IUPAC name of N-phenyltetrazol-1-amine (CID 18671860) is N-phenyltetrazol-1-amine.
What is the SMILES notation for N-phenyltetrazol-1-amine?
The canonical SMILES for N-phenyltetrazol-1-amine is c1ccc(Nn2cnnn2)cc1.
What is the InChIKey of N-phenyltetrazol-1-amine?
The InChIKey is AYXRANNMPTXHLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5/c1-2-4-7(5-3-1)9-12-6-8-10-11-12/h1-6,9H.
What are the key properties of N-phenyltetrazol-1-amine?
N-phenyltetrazol-1-amine has a molecular weight of 161.17 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenyltetrazol-1-amine is sourced from PubChem (CID 18671860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).