C20H26F3N7O5 — CID 18671913
N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetamide;2,2,2-trifluoroacetic acid (PubChem CID 18671913) has the molecular formula C20H26F3N7O5 and a molecular weight of 501.47 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18671913 |
| Molecular Formula | C20H26F3N7O5 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[6-methyl-2-oxo-3-(2-phenylethylamino)pyrazin-1-yl]acetamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cnc(NCCc2ccccc2)c(=O)n1CC(=O)NCCON=C(N)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N7O3.C2HF3O2/c1-13-11-23-16(22-8-7-14-5-3-2-4-6-14)17(27)25(13)12-15(26)21-9-10-28-24-18(19)20;3-2(4,5)1(6)7/h2-6,11H,7-10,12H2,1H3,(H,21,26)(H,22,23)(H4,19,20,24);(H,6,7) |
| InChIKey | OSVXTKIYRJEDGP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|