C19H26ClN7O3 — CID 18671942
N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-(2,3-dihydro-1H-inden-2-ylamino)-6-methyl-2-oxopyrazin-1-yl]acetamide;hydrochloride (PubChem CID 18671942) has the molecular formula C19H26ClN7O3 and a molecular weight of 435.92 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-(2,3-dihydro-1H-inden-2-ylamino)-6-methyl-2-oxopyrazin-1-yl]acetamide;hydrochloride.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-(2,3-dihydro-1H-inden-2-ylamino)-6-methyl-2-oxopyrazin-1-yl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 18671942 |
| Molecular Formula | C19H26ClN7O3 |
| Molecular Weight | 435.92 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[3-(2,3-dihydro-1H-inden-2-ylamino)-6-methyl-2-oxopyrazin-1-yl]acetamide;hydrochloride |
| SMILES | Cc1cnc(NC2Cc3ccccc3C2)c(=O)n1CC(=O)NCCON=C(N)N.Cl |
| InChI | InChI=1S/C19H25N7O3.ClH/c1-12-10-23-17(24-15-8-13-4-2-3-5-14(13)9-15)18(28)26(12)11-16(27)22-6-7-29-25-19(20)21;/h2-5,10,15H,6-9,11H2,1H3,(H,22,27)(H,23,24)(H4,20,21,25);1H |
| InChIKey | BCXAOUXIJNTTSB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.92 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|