C27H29N3O4 — CID 18671960
4-[[9-benzyl-5-carbamoyl-2-(2-cyanoethyl)-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid (PubChem CID 18671960) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[[9-benzyl-5-carbamoyl-2-(2-cyanoethyl)-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid.
| Compound Name | 4-[[9-benzyl-5-carbamoyl-2-(2-cyanoethyl)-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid |
|---|---|
| PubChem CID | 18671960 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[[9-benzyl-5-carbamoyl-2-(2-cyanoethyl)-5,6,7,8-tetrahydrocarbazol-3-yl]oxy]butanoic acid |
| SMILES | N#CCCc1cc2c(cc1OCCCC(=O)O)c1c(n2Cc2ccccc2)CCCC1C(N)=O |
| InChI | InChI=1S/C27H29N3O4/c28-13-5-9-19-15-23-21(16-24(19)34-14-6-12-25(31)32)26-20(27(29)33)10-4-11-22(26)30(23)17-18-7-2-1-3-8-18/h1-3,7-8,15-16,20H,4-6,9-12,14,17H2,(H2,29,33)(H,31,32) |
| InChIKey | PHLMLOIEAYWBBX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|