C22H26Cl3NO5 — CID 18671965
2-[bis(2-chloroethyl)amino]ethyl 2-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)acetate;hydrochloride (PubChem CID 18671965) has the molecular formula C22H26Cl3NO5 and a molecular weight of 490.81 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino]ethyl 2-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)acetate;hydrochloride.
| Compound Name | 2-[bis(2-chloroethyl)amino]ethyl 2-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 18671965 |
| Molecular Formula | C22H26Cl3NO5 |
| Molecular Weight | 490.81 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino]ethyl 2-(2,5,9-trimethyl-7-oxofuro[3,2-g]chromen-3-yl)acetate;hydrochloride |
| SMILES | Cc1oc2c(C)c3oc(=O)cc(C)c3cc2c1CC(=O)OCCN(CCCl)CCCl.Cl |
| InChI | InChI=1S/C22H25Cl2NO5.ClH/c1-13-10-20(27)30-21-14(2)22-18(11-16(13)21)17(15(3)29-22)12-19(26)28-9-8-25(6-4-23)7-5-24;/h10-11H,4-9,12H2,1-3H3;1H |
| InChIKey | NVAIIBXRDBKHQV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.81 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|