About 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride
2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride (PubChem CID 18671967) has the molecular formula C6H16Cl2N2O3
and a molecular weight of 235.11 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride |
| PubChem CID | 18671967 |
| Molecular Formula | C6H16Cl2N2O3 |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)CN(CCO)CCO |
| InChI | InChI=1S/C6H14N2O3.2ClH/c7-6(11)5-8(1-3-9)2-4-10;;/h9-10H,1-5H2,(H2,7,11);2*1H |
| InChIKey | WIJKQIXSHZCLKW-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride (CID 18671967) is 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride is Cl.Cl.NC(=O)CN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride?
The InChIKey is WIJKQIXSHZCLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3.2ClH/c7-6(11)5-8(1-3-9)2-4-10;;/h9-10H,1-5H2,(H2,7,11);2*1H.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride?
2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride has a molecular weight of 235.11 g/mol, XLogP of -1.40, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]acetamide;dihydrochloride is sourced from PubChem (CID 18671967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).