C21H16F2N4O2S4 — CID 18672193
4-[4-[3-[(2,4-difluorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 18672193) has the molecular formula C21H16F2N4O2S4 and a molecular weight of 522.65 g/mol. Its IUPAC name is 4-[4-[3-[(2,4-difluorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide.
| Compound Name | 4-[4-[3-[(2,4-difluorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18672193 |
| Molecular Formula | C21H16F2N4O2S4 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 4-[4-[3-[(2,4-difluorophenyl)sulfonylamino]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(NS(=O)(=O)c4ccc(F)cc4F)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C21H16F2N4O2S4/c1-30-21-14(9-17(32-21)19(24)25)20-26-16(10-31-20)11-3-2-4-13(7-11)27-33(28,29)18-6-5-12(22)8-15(18)23/h2-10,27H,1H3,(H3,24,25) |
| InChIKey | DUOUNUFJLXSZFE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|