C44H52Si — CID 18672948
[4-[3,6-ditert-butyl-9-(2,2-diphenylpropyl)-9H-fluoren-1-yl]cyclopenta-1,4-dien-1-yl]-trimethylsilane (PubChem CID 18672948) has the molecular formula C44H52Si and a molecular weight of 608.99 g/mol. Its IUPAC name is [4-[3,6-ditert-butyl-9-(2,2-diphenylpropyl)-9H-fluoren-1-yl]cyclopenta-1,4-dien-1-yl]-trimethylsilane.
| Compound Name | [4-[3,6-ditert-butyl-9-(2,2-diphenylpropyl)-9H-fluoren-1-yl]cyclopenta-1,4-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 18672948 |
| Molecular Formula | C44H52Si |
| Molecular Weight | 608.99 g/mol |
| Exact Mass | 608.38 |
| IUPAC Name | [4-[3,6-ditert-butyl-9-(2,2-diphenylpropyl)-9H-fluoren-1-yl]cyclopenta-1,4-dien-1-yl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccc2c(c1)-c1cc(C(C)(C)C)cc(C3=CC([Si](C)(C)C)=CC3)c1C2CC(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H52Si/c1-42(2,3)33-22-24-36-38(26-33)39-28-34(43(4,5)6)27-37(30-21-23-35(25-30)45(8,9)10)41(39)40(36)29-44(7,31-17-13-11-14-18-31)32-19-15-12-16-20-32/h11-20,22-28,40H,21,29H2,1-10H3 |
| InChIKey | BVFSHFTZTCKVIZ-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.99 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|