C8H15N5 — CID 18673
6-pentyl-1,3,5-triazine-2,4-diamine (PubChem CID 18673) has the molecular formula C8H15N5 and a molecular weight of 181.24 g/mol. Its IUPAC name is 6-pentyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-pentyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 18673 |
| Molecular Formula | C8H15N5 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 6-pentyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCCc1nc(N)nc(N)n1 |
| InChI | InChI=1S/C8H15N5/c1-2-3-4-5-6-11-7(9)13-8(10)12-6/h2-5H2,1H3,(H4,9,10,11,12,13) |
| InChIKey | PJGTYLODAXOMPC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|