C10H20B2O4 — CID 18673250
4,4,5-trimethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 18673250) has the molecular formula C10H20B2O4 and a molecular weight of 225.89 g/mol. Its IUPAC name is 4,4,5-trimethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5-trimethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 18673250 |
| Molecular Formula | C10H20B2O4 |
| Molecular Weight | 225.89 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 4,4,5-trimethyl-2-(4,4,5-trimethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1OB(B2OC(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C10H20B2O4/c1-7-9(3,4)15-11(13-7)12-14-8(2)10(5,6)16-12/h7-8H,1-6H3 |
| InChIKey | BUYDMXHVALZHGU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.89 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|