About 8-methoxy-7,7-dimethyl-8-oxooctanoic acid
8-methoxy-7,7-dimethyl-8-oxooctanoic acid (PubChem CID 18673401) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 8-methoxy-7,7-dimethyl-8-oxooctanoic acid.
Molecular Properties
| Compound Name | 8-methoxy-7,7-dimethyl-8-oxooctanoic acid |
| PubChem CID | 18673401 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 8-methoxy-7,7-dimethyl-8-oxooctanoic acid |
| SMILES | COC(=O)C(C)(C)CCCCCC(=O)O |
| InChI | InChI=1S/C11H20O4/c1-11(2,10(14)15-3)8-6-4-5-7-9(12)13/h4-8H2,1-3H3,(H,12,13) |
| InChIKey | NOTWDMQWUPOWNS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-methoxy-7,7-dimethyl-8-oxooctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-7,7-dimethyl-8-oxooctanoic acid?
The IUPAC name of 8-methoxy-7,7-dimethyl-8-oxooctanoic acid (CID 18673401) is 8-methoxy-7,7-dimethyl-8-oxooctanoic acid.
What is the SMILES notation for 8-methoxy-7,7-dimethyl-8-oxooctanoic acid?
The canonical SMILES for 8-methoxy-7,7-dimethyl-8-oxooctanoic acid is COC(=O)C(C)(C)CCCCCC(=O)O.
What is the InChIKey of 8-methoxy-7,7-dimethyl-8-oxooctanoic acid?
The InChIKey is NOTWDMQWUPOWNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-11(2,10(14)15-3)8-6-4-5-7-9(12)13/h4-8H2,1-3H3,(H,12,13).
What are the key properties of 8-methoxy-7,7-dimethyl-8-oxooctanoic acid?
8-methoxy-7,7-dimethyl-8-oxooctanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.22, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-7,7-dimethyl-8-oxooctanoic acid is sourced from PubChem (CID 18673401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).