About spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol
spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (PubChem CID 18673581) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
Molecular Properties
| Compound Name | spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| PubChem CID | 18673581 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol |
| SMILES | OC1Cc2ccccc2C12CCNCC2 |
| InChI | InChI=1S/C13H17NO/c15-12-9-10-3-1-2-4-11(10)13(12)5-7-14-8-6-13/h1-4,12,14-15H,5-9H2 |
| InChIKey | DBCKHYVIUIDGOH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The IUPAC name of spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol (CID 18673581) is spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol.
What is the SMILES notation for spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The canonical SMILES for spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol is OC1Cc2ccccc2C12CCNCC2.
What is the InChIKey of spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
The InChIKey is DBCKHYVIUIDGOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c15-12-9-10-3-1-2-4-11(10)13(12)5-7-14-8-6-13/h1-4,12,14-15H,5-9H2.
What are the key properties of spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol?
spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol has a molecular weight of 203.28 g/mol, XLogP of 1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,2-dihydroindene-3,4'-piperidine]-2-ol is sourced from PubChem (CID 18673581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).