About spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride
spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride (PubChem CID 18673582) has the molecular formula C13H16ClNO
and a molecular weight of 237.73 g/mol. Its IUPAC name is spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride.
Molecular Properties
| Compound Name | spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride |
| PubChem CID | 18673582 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride |
| SMILES | Cl.O=C1CC2(CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C13H15NO.ClH/c15-12-9-13(5-7-14-8-6-13)11-4-2-1-3-10(11)12;/h1-4,14H,5-9H2;1H |
| InChIKey | ZJEHLHIBZLOSAQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride?
The IUPAC name of spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride (CID 18673582) is spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride.
What is the SMILES notation for spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride?
The canonical SMILES for spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride is Cl.O=C1CC2(CCNCC2)c2ccccc21.
What is the InChIKey of spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride?
The InChIKey is ZJEHLHIBZLOSAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO.ClH/c15-12-9-13(5-7-14-8-6-13)11-4-2-1-3-10(11)12;/h1-4,14H,5-9H2;1H.
What are the key properties of spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride?
spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride has a molecular weight of 237.73 g/mol, XLogP of 2.32, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2H-indene-3,4'-piperidine]-1-one;hydrochloride is sourced from PubChem (CID 18673582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).