C11H12F3NO5S — CID 18674538
[(Z)-[1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate (PubChem CID 18674538) has the molecular formula C11H12F3NO5S and a molecular weight of 327.28 g/mol. Its IUPAC name is [(Z)-[1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate.
| Compound Name | [(Z)-[1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate |
|---|---|
| PubChem CID | 18674538 |
| Molecular Formula | C11H12F3NO5S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | [(Z)-[1-(3,4-dimethoxyphenyl)-2,2,2-trifluoroethylidene]amino] methanesulfonate |
| SMILES | COc1ccc(/C(=N/OS(C)(=O)=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C11H12F3NO5S/c1-18-8-5-4-7(6-9(8)19-2)10(11(12,13)14)15-20-21(3,16)17/h4-6H,1-3H3/b15-10- |
| InChIKey | UNDUBSFFCCNNOH-GDNBJRDFSA-N |
| XLogP | 1.95 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|