About azane;phosphonomethylphosphonic acid
azane;phosphonomethylphosphonic acid (PubChem CID 18674565) has the molecular formula C2H15NO12P4
and a molecular weight of 369.03 g/mol. Its IUPAC name is azane;phosphonomethylphosphonic acid.
Molecular Properties
| Compound Name | azane;phosphonomethylphosphonic acid |
| PubChem CID | 18674565 |
| Molecular Formula | C2H15NO12P4 |
| Molecular Weight | 369.03 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | azane;phosphonomethylphosphonic acid |
| SMILES | N.O=P(O)(O)CP(=O)(O)O.O=P(O)(O)CP(=O)(O)O |
| InChI | InChI=1S/2CH6O6P2.H3N/c2*2-8(3,4)1-9(5,6)7;/h2*1H2,(H2,2,3,4)(H2,5,6,7);1H3 |
| InChIKey | KUEXFZGCLUPWEI-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 265.12 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.03 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azane;phosphonomethylphosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;phosphonomethylphosphonic acid?
The IUPAC name of azane;phosphonomethylphosphonic acid (CID 18674565) is azane;phosphonomethylphosphonic acid.
What is the SMILES notation for azane;phosphonomethylphosphonic acid?
The canonical SMILES for azane;phosphonomethylphosphonic acid is N.O=P(O)(O)CP(=O)(O)O.O=P(O)(O)CP(=O)(O)O.
What is the InChIKey of azane;phosphonomethylphosphonic acid?
The InChIKey is KUEXFZGCLUPWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH6O6P2.H3N/c2*2-8(3,4)1-9(5,6)7;/h2*1H2,(H2,2,3,4)(H2,5,6,7);1H3.
What are the key properties of azane;phosphonomethylphosphonic acid?
azane;phosphonomethylphosphonic acid has a molecular weight of 369.03 g/mol, XLogP of -1.24, 4 rotatable bonds, 9 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;phosphonomethylphosphonic acid is sourced from PubChem (CID 18674565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).