C16H34O8 — CID 18674883
2,5-bis(tert-butylperoxy)-3,4-dihydroperoxy-2,5-dimethylhexane (PubChem CID 18674883) has the molecular formula C16H34O8 and a molecular weight of 354.44 g/mol. Its IUPAC name is 2,5-bis(tert-butylperoxy)-3,4-dihydroperoxy-2,5-dimethylhexane.
| Compound Name | 2,5-bis(tert-butylperoxy)-3,4-dihydroperoxy-2,5-dimethylhexane |
|---|---|
| PubChem CID | 18674883 |
| Molecular Formula | C16H34O8 |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 2,5-bis(tert-butylperoxy)-3,4-dihydroperoxy-2,5-dimethylhexane |
| SMILES | CC(C)(C)OOC(C)(C)C(OO)C(OO)C(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C16H34O8/c1-13(2,3)21-23-15(7,8)11(19-17)12(20-18)16(9,10)24-22-14(4,5)6/h11-12,17-18H,1-10H3 |
| InChIKey | BVCDCAYQFLFCBC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|