About 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol
3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol (PubChem CID 18674981) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol |
| PubChem CID | 18674981 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol |
| SMILES | COc1cc(-c2ncccc2CCCO)cc(OC)c1OC |
| InChI | InChI=1S/C17H21NO4/c1-20-14-10-13(11-15(21-2)17(14)22-3)16-12(7-5-9-19)6-4-8-18-16/h4,6,8,10-11,19H,5,7,9H2,1-3H3 |
| InChIKey | NLQRRMXSOJQERA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol?
The IUPAC name of 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol (CID 18674981) is 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol.
What is the SMILES notation for 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol?
The canonical SMILES for 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol is COc1cc(-c2ncccc2CCCO)cc(OC)c1OC.
What is the InChIKey of 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol?
The InChIKey is NLQRRMXSOJQERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-20-14-10-13(11-15(21-2)17(14)22-3)16-12(7-5-9-19)6-4-8-18-16/h4,6,8,10-11,19H,5,7,9H2,1-3H3.
What are the key properties of 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol?
3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol has a molecular weight of 303.36 g/mol, XLogP of 2.70, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propan-1-ol is sourced from PubChem (CID 18674981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).