C27H36N2O3 — CID 18675223
4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-2-(4-methoxyphenyl)-1,4-benzoxazin-3-one (PubChem CID 18675223) has the molecular formula C27H36N2O3 and a molecular weight of 436.60 g/mol. Its IUPAC name is 4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-2-(4-methoxyphenyl)-1,4-benzoxazin-3-one.
| Compound Name | 4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-2-(4-methoxyphenyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 18675223 |
| Molecular Formula | C27H36N2O3 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.27 |
| IUPAC Name | 4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-2-(4-methoxyphenyl)-1,4-benzoxazin-3-one |
| SMILES | COc1ccc(C2Oc3ccccc3N(CCCCCN3C(C)CCCC3C)C2=O)cc1 |
| InChI | InChI=1S/C27H36N2O3/c1-20-10-9-11-21(2)28(20)18-7-4-8-19-29-24-12-5-6-13-25(24)32-26(27(29)30)22-14-16-23(31-3)17-15-22/h5-6,12-17,20-21,26H,4,7-11,18-19H2,1-3H3 |
| InChIKey | IIVFKZRYVBKPLV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|