C27H37N3O2 — CID 18675252
2-[3-(aminomethyl)phenyl]-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-1,4-benzoxazin-3-one (PubChem CID 18675252) has the molecular formula C27H37N3O2 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[3-(aminomethyl)phenyl]-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-1,4-benzoxazin-3-one.
| Compound Name | 2-[3-(aminomethyl)phenyl]-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 18675252 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 2-[3-(aminomethyl)phenyl]-4-[5-(2,6-dimethylpiperidin-1-yl)pentyl]-1,4-benzoxazin-3-one |
| SMILES | CC1CCCC(C)N1CCCCCN1C(=O)C(c2cccc(CN)c2)Oc2ccccc21 |
| InChI | InChI=1S/C27H37N3O2/c1-20-10-8-11-21(2)29(20)16-6-3-7-17-30-24-14-4-5-15-25(24)32-26(27(30)31)23-13-9-12-22(18-23)19-28/h4-5,9,12-15,18,20-21,26H,3,6-8,10-11,16-17,19,28H2,1-2H3 |
| InChIKey | ULSZLAGIIKREDZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|