About methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate
methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate (PubChem CID 18675624) has the molecular formula C26H35NO5
and a molecular weight of 441.57 g/mol. Its IUPAC name is methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate |
| PubChem CID | 18675624 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate |
| SMILES | CCCCN(CCCC)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)OC |
| InChI | InChI=1S/C26H35NO5/c1-4-6-18-27(19-7-5-2)23(28)20-32-26(24(29)25(30)31-3,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,24,29H,4-7,18-20H2,1-3H3 |
| InChIKey | RKIMJBITPPGAGM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate?
The IUPAC name of methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate (CID 18675624) is methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate.
What is the SMILES notation for methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate?
The canonical SMILES for methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate is CCCCN(CCCC)C(=O)COC(c1ccccc1)(c1ccccc1)C(O)C(=O)OC.
What is the InChIKey of methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate?
The InChIKey is RKIMJBITPPGAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H35NO5/c1-4-6-18-27(19-7-5-2)23(28)20-32-26(24(29)25(30)31-3,21-14-10-8-11-15-21)22-16-12-9-13-17-22/h8-17,24,29H,4-7,18-20H2,1-3H3.
What are the key properties of methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate?
methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate has a molecular weight of 441.57 g/mol, XLogP of 3.91, 13 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(dibutylamino)-2-oxoethoxy]-2-hydroxy-3,3-diphenylpropanoate is sourced from PubChem (CID 18675624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).