C16H26O3 — CID 18676254
2,4-ditert-butyl-4-hydroxy-6-methylcyclohexa-2,5-diene-1-carboxylic acid (PubChem CID 18676254) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2,4-ditert-butyl-4-hydroxy-6-methylcyclohexa-2,5-diene-1-carboxylic acid.
| Compound Name | 2,4-ditert-butyl-4-hydroxy-6-methylcyclohexa-2,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 18676254 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2,4-ditert-butyl-4-hydroxy-6-methylcyclohexa-2,5-diene-1-carboxylic acid |
| SMILES | CC1=CC(O)(C(C)(C)C)C=C(C(C)(C)C)C1C(=O)O |
| InChI | InChI=1S/C16H26O3/c1-10-8-16(19,15(5,6)7)9-11(14(2,3)4)12(10)13(17)18/h8-9,12,19H,1-7H3,(H,17,18) |
| InChIKey | WFIUMBJQZGUOPS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|