About 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine
5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine (PubChem CID 18676367) has the molecular formula C13H22N2S2
and a molecular weight of 270.47 g/mol. Its IUPAC name is 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine |
| PubChem CID | 18676367 |
| Molecular Formula | C13H22N2S2 |
| Molecular Weight | 270.47 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine |
| SMILES | CCSc1c(N)c(C)c(N)c(SCC)c1CC |
| InChI | InChI=1S/C13H22N2S2/c1-5-9-12(16-6-2)10(14)8(4)11(15)13(9)17-7-3/h5-7,14-15H2,1-4H3 |
| InChIKey | JAXNVXBDHAWLJV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine?
The IUPAC name of 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine (CID 18676367) is 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine.
What is the SMILES notation for 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine?
The canonical SMILES for 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine is CCSc1c(N)c(C)c(N)c(SCC)c1CC.
What is the InChIKey of 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine?
The InChIKey is JAXNVXBDHAWLJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2S2/c1-5-9-12(16-6-2)10(14)8(4)11(15)13(9)17-7-3/h5-7,14-15H2,1-4H3.
What are the key properties of 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine?
5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine has a molecular weight of 270.47 g/mol, XLogP of 3.95, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-4,6-bis(ethylsulfanyl)-2-methylbenzene-1,3-diamine is sourced from PubChem (CID 18676367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).