About 8,9a-dihydropyrano[3,2-g]chromen-6-amine
8,9a-dihydropyrano[3,2-g]chromen-6-amine (PubChem CID 18678003) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is 8,9a-dihydropyrano[3,2-g]chromen-6-amine.
Molecular Properties
| Compound Name | 8,9a-dihydropyrano[3,2-g]chromen-6-amine |
| PubChem CID | 18678003 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 8,9a-dihydropyrano[3,2-g]chromen-6-amine |
| SMILES | NC1=CCOC2C=C3OC=CC=C3C=C12 |
| InChI | InChI=1S/C12H11NO2/c13-10-3-5-15-12-7-11-8(6-9(10)12)2-1-4-14-11/h1-4,6-7,12H,5,13H2 |
| InChIKey | YRUNLIABNJRLRM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8,9a-dihydropyrano[3,2-g]chromen-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9a-dihydropyrano[3,2-g]chromen-6-amine?
The IUPAC name of 8,9a-dihydropyrano[3,2-g]chromen-6-amine (CID 18678003) is 8,9a-dihydropyrano[3,2-g]chromen-6-amine.
What is the SMILES notation for 8,9a-dihydropyrano[3,2-g]chromen-6-amine?
The canonical SMILES for 8,9a-dihydropyrano[3,2-g]chromen-6-amine is NC1=CCOC2C=C3OC=CC=C3C=C12.
What is the InChIKey of 8,9a-dihydropyrano[3,2-g]chromen-6-amine?
The InChIKey is YRUNLIABNJRLRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c13-10-3-5-15-12-7-11-8(6-9(10)12)2-1-4-14-11/h1-4,6-7,12H,5,13H2.
What are the key properties of 8,9a-dihydropyrano[3,2-g]chromen-6-amine?
8,9a-dihydropyrano[3,2-g]chromen-6-amine has a molecular weight of 201.22 g/mol, XLogP of 1.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9a-dihydropyrano[3,2-g]chromen-6-amine is sourced from PubChem (CID 18678003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).