About propyl 2,3-dihydroxypropanoate
propyl 2,3-dihydroxypropanoate (PubChem CID 18678010) has the molecular formula C6H12O4
and a molecular weight of 148.16 g/mol. Its IUPAC name is propyl 2,3-dihydroxypropanoate.
Molecular Properties
| Compound Name | propyl 2,3-dihydroxypropanoate |
| PubChem CID | 18678010 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | propyl 2,3-dihydroxypropanoate |
| SMILES | CCCOC(=O)C(O)CO |
| InChI | InChI=1S/C6H12O4/c1-2-3-10-6(9)5(8)4-7/h5,7-8H,2-4H2,1H3 |
| InChIKey | SFNVWNJSIUCHES-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propyl 2,3-dihydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 2,3-dihydroxypropanoate?
The IUPAC name of propyl 2,3-dihydroxypropanoate (CID 18678010) is propyl 2,3-dihydroxypropanoate.
What is the SMILES notation for propyl 2,3-dihydroxypropanoate?
The canonical SMILES for propyl 2,3-dihydroxypropanoate is CCCOC(=O)C(O)CO.
What is the InChIKey of propyl 2,3-dihydroxypropanoate?
The InChIKey is SFNVWNJSIUCHES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O4/c1-2-3-10-6(9)5(8)4-7/h5,7-8H,2-4H2,1H3.
What are the key properties of propyl 2,3-dihydroxypropanoate?
propyl 2,3-dihydroxypropanoate has a molecular weight of 148.16 g/mol, XLogP of -0.71, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 2,3-dihydroxypropanoate is sourced from PubChem (CID 18678010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).