About 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one
4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one (PubChem CID 18678587) has the molecular formula C25H29F3N2O3
and a molecular weight of 462.51 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one.
Molecular Properties
| Compound Name | 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one |
| PubChem CID | 18678587 |
| Molecular Formula | C25H29F3N2O3 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one |
| SMILES | O=C1c2ccccc2-c2c(OCC(O)CNC(CCC(F)(F)F)C3CCNCC3)cccc21 |
| InChI | InChI=1S/C25H29F3N2O3/c26-25(27,28)11-8-21(16-9-12-29-13-10-16)30-14-17(31)15-33-22-7-3-6-20-23(22)18-4-1-2-5-19(18)24(20)32/h1-7,16-17,21,29-31H,8-15H2 |
| InChIKey | MTVOUESNQLARKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one?
The IUPAC name of 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one (CID 18678587) is 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one.
What is the SMILES notation for 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one?
The canonical SMILES for 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one is O=C1c2ccccc2-c2c(OCC(O)CNC(CCC(F)(F)F)C3CCNCC3)cccc21.
What is the InChIKey of 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one?
The InChIKey is MTVOUESNQLARKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29F3N2O3/c26-25(27,28)11-8-21(16-9-12-29-13-10-16)30-14-17(31)15-33-22-7-3-6-20-23(22)18-4-1-2-5-19(18)24(20)32/h1-7,16-17,21,29-31H,8-15H2.
What are the key properties of 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one?
4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one has a molecular weight of 462.51 g/mol, XLogP of 3.94, 9 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-hydroxy-3-[(4,4,4-trifluoro-1-piperidin-4-ylbutyl)amino]propoxy]fluoren-9-one is sourced from PubChem (CID 18678587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).