C5H3F9 — CID 18678984
1,1,1,2,2,3,3,4,4-nonafluoropentane (PubChem CID 18678984) has the molecular formula C5H3F9 and a molecular weight of 234.06 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoropentane.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoropentane |
|---|---|
| PubChem CID | 18678984 |
| Molecular Formula | C5H3F9 |
| Molecular Weight | 234.06 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoropentane |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9/c1-2(6,7)3(8,9)4(10,11)5(12,13)14/h1H3 |
| InChIKey | RGRJUIGTKHAMBM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.06 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|