C12H14F6O2 — CID 18679147
2-(2-bicyclo[2.2.1]hept-5-enylmethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 18679147) has the molecular formula C12H14F6O2 and a molecular weight of 304.23 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]hept-5-enylmethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 18679147 |
| Molecular Formula | C12H14F6O2 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]hept-5-enylmethoxymethyl)-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(COCC1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6O2/c13-11(14,15)10(19,12(16,17)18)6-20-5-9-4-7-1-2-8(9)3-7/h1-2,7-9,19H,3-6H2 |
| InChIKey | WVMDVYUYUFUFQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|